C20H20N4O — CID 109191220
5-(3,5-dimethylanilino)-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 109191220) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 5-(3,5-dimethylanilino)-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 5-(3,5-dimethylanilino)-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109191220 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 5-(3,5-dimethylanilino)-N-(pyridin-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2ccc(C(=O)NCc3cccnc3)nc2)c1 |
| InChI | InChI=1S/C20H20N4O/c1-14-8-15(2)10-18(9-14)24-17-5-6-19(22-13-17)20(25)23-12-16-4-3-7-21-11-16/h3-11,13,24H,12H2,1-2H3,(H,23,25) |
| InChIKey | VJDFVZGRZWVKGT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |