C36H52O8 — CID 10919179
(4S,6S)-4,6-bis[[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane (PubChem CID 10919179) has the molecular formula C36H52O8 and a molecular weight of 612.80 g/mol. Its IUPAC name is (4S,6S)-4,6-bis[[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4S,6S)-4,6-bis[[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 10919179 |
| Molecular Formula | C36H52O8 |
| Molecular Weight | 612.80 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | (4S,6S)-4,6-bis[[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)O[C@H](C[C@@H]2C[C@H](COCc3ccccc3)OC(C)(C)O2)C[C@@H](C[C@@H]2C[C@H](COCc3ccccc3)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C36H52O8/c1-34(2)39-28(18-30-20-32(43-35(3,4)41-30)24-37-22-26-13-9-7-10-14-26)17-29(40-34)19-31-21-33(44-36(5,6)42-31)25-38-23-27-15-11-8-12-16-27/h7-16,28-33H,17-25H2,1-6H3/t28-,29-,30+,31+,32+,33+/m0/s1 |
| InChIKey | UZZZJSFCFATUCR-HNTSJLFCSA-N |
| XLogP | 6.93 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.80 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |