C22H22FN3O — CID 109191849
N-[2-(4-fluorophenyl)ethyl]-5-(2-phenylethylamino)pyridine-2-carboxamide (PubChem CID 109191849) has the molecular formula C22H22FN3O and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-5-(2-phenylethylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-5-(2-phenylethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109191849 |
| Molecular Formula | C22H22FN3O |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-5-(2-phenylethylamino)pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccc(F)cc1)c1ccc(NCCc2ccccc2)cn1 |
| InChI | InChI=1S/C22H22FN3O/c23-19-8-6-18(7-9-19)13-15-25-22(27)21-11-10-20(16-26-21)24-14-12-17-4-2-1-3-5-17/h1-11,16,24H,12-15H2,(H,25,27) |
| InChIKey | SEBWUZXBLPMDTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |