C18H21N3O4S — CID 109193090
N-(1,1-dioxothiolan-3-yl)-5-(2-ethoxyanilino)pyridine-2-carboxamide (PubChem CID 109193090) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-(2-ethoxyanilino)pyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-(2-ethoxyanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109193090 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-(2-ethoxyanilino)pyridine-2-carboxamide |
| SMILES | CCOc1ccccc1Nc1ccc(C(=O)NC2CCS(=O)(=O)C2)nc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-2-25-17-6-4-3-5-15(17)20-13-7-8-16(19-11-13)18(22)21-14-9-10-26(23,24)12-14/h3-8,11,14,20H,2,9-10,12H2,1H3,(H,21,22) |
| InChIKey | DEKAYQLRESERBF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |