C22H20N4O3 — CID 109193758
5-(4-cyanoanilino)-N-[(3,4-dimethoxyphenyl)methyl]pyridine-2-carboxamide (PubChem CID 109193758) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 5-(4-cyanoanilino)-N-[(3,4-dimethoxyphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-(4-cyanoanilino)-N-[(3,4-dimethoxyphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109193758 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 5-(4-cyanoanilino)-N-[(3,4-dimethoxyphenyl)methyl]pyridine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(Nc3ccc(C#N)cc3)cn2)cc1OC |
| InChI | InChI=1S/C22H20N4O3/c1-28-20-10-5-16(11-21(20)29-2)13-25-22(27)19-9-8-18(14-24-19)26-17-6-3-15(12-23)4-7-17/h3-11,14,26H,13H2,1-2H3,(H,25,27) |
| InChIKey | YDKJYBYYAAYJGD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |