C30H51BrO9Si — CID 10919437
(4E,7S,8R,9Z,11E,13Z)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoic acid (PubChem CID 10919437) has the molecular formula C30H51BrO9Si and a molecular weight of 663.72 g/mol. Its IUPAC name is (4E,7S,8R,9Z,11E,13Z)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoic acid.
| Compound Name | (4E,7S,8R,9Z,11E,13Z)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoic acid |
|---|---|
| PubChem CID | 10919437 |
| Molecular Formula | C30H51BrO9Si |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | (4E,7S,8R,9Z,11E,13Z)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoic acid |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](C)O[C@@H](O[C@@H](C/C=C/CCC(=O)O)[C@@H](/C=C(Br)/C=C/C=C\CO)O[Si](C)(C)C(C)(C)C)[C@@H]1OC |
| InChI | InChI=1S/C30H51BrO9Si/c1-21-26(35-5)27(36-6)28(37-7)29(38-21)39-23(17-13-10-14-18-25(33)34)24(40-41(8,9)30(2,3)4)20-22(31)16-12-11-15-19-32/h10-13,15-16,20-21,23-24,26-29,32H,14,17-19H2,1-9H3,(H,33,34)/b13-10+,15-11-,16-12+,22-20-/t21-,23-,24+,26-,27+,28+,29-/m0/s1 |
| InChIKey | XSUAWRYFCMPJOW-QFOIQDHFSA-N |
| XLogP | 5.75 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|