C20H19FN6O — CID 109194543
[5-(3-fluoroanilino)-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109194543) has the molecular formula C20H19FN6O and a molecular weight of 378.41 g/mol. Its IUPAC name is [5-(3-fluoroanilino)-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-(3-fluoroanilino)-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109194543 |
| Molecular Formula | C20H19FN6O |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [5-(3-fluoroanilino)-2-pyridinyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(Nc2cccc(F)c2)cn1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H19FN6O/c21-15-3-1-4-16(13-15)25-17-5-6-18(24-14-17)19(28)26-9-11-27(12-10-26)20-22-7-2-8-23-20/h1-8,13-14,25H,9-12H2 |
| InChIKey | RETKDVRCSLKNKG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |