C19H25N3O — CID 109195520
5-(2,3-dimethylanilino)-N-(3-methylbutyl)pyridine-2-carboxamide (PubChem CID 109195520) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-(2,3-dimethylanilino)-N-(3-methylbutyl)pyridine-2-carboxamide.
| Compound Name | 5-(2,3-dimethylanilino)-N-(3-methylbutyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109195520 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 5-(2,3-dimethylanilino)-N-(3-methylbutyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(Nc2ccc(C(=O)NCCC(C)C)nc2)c1C |
| InChI | InChI=1S/C19H25N3O/c1-13(2)10-11-20-19(23)18-9-8-16(12-21-18)22-17-7-5-6-14(3)15(17)4/h5-9,12-13,22H,10-11H2,1-4H3,(H,20,23) |
| InChIKey | XWWPKKLLMABIGF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |