About palladium;bis(triphenylarsane)
palladium;bis(triphenylarsane) (PubChem CID 10919635) has the molecular formula C36H30As2Pd
and a molecular weight of 718.90 g/mol. Its IUPAC name is palladium;bis(triphenylarsane).
Molecular Properties
| Compound Name | palladium;bis(triphenylarsane) |
| PubChem CID | 10919635 |
| Molecular Formula | C36H30As2Pd |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 717.98 |
| IUPAC Name | palladium;bis(triphenylarsane) |
| SMILES | [Pd].c1ccc([As](c2ccccc2)c2ccccc2)cc1.c1ccc([As](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15As.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H; |
| InChIKey | IOMYAOJNAXYVBB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze palladium;bis(triphenylarsane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;bis(triphenylarsane)?
The IUPAC name of palladium;bis(triphenylarsane) (CID 10919635) is palladium;bis(triphenylarsane).
What is the SMILES notation for palladium;bis(triphenylarsane)?
The canonical SMILES for palladium;bis(triphenylarsane) is [Pd].c1ccc([As](c2ccccc2)c2ccccc2)cc1.c1ccc([As](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of palladium;bis(triphenylarsane)?
The InChIKey is IOMYAOJNAXYVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H15As.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;.
What are the key properties of palladium;bis(triphenylarsane)?
palladium;bis(triphenylarsane) has a molecular weight of 718.90 g/mol, XLogP of 4.40, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;bis(triphenylarsane) is sourced from PubChem (CID 10919635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).