C21H19N3O2 — CID 109197827
5-(2,3-dihydroindol-1-yl)-N-(2-methoxyphenyl)pyridine-2-carboxamide (PubChem CID 109197827) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-yl)-N-(2-methoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(2,3-dihydroindol-1-yl)-N-(2-methoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109197827 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5-(2,3-dihydroindol-1-yl)-N-(2-methoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(N2CCc3ccccc32)cn1 |
| InChI | InChI=1S/C21H19N3O2/c1-26-20-9-5-3-7-17(20)23-21(25)18-11-10-16(14-22-18)24-13-12-15-6-2-4-8-19(15)24/h2-11,14H,12-13H2,1H3,(H,23,25) |
| InChIKey | JHJFROVGTPUWOS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |