C22H21N3O3 — CID 109198757
N-(1,3-benzodioxol-5-yl)-5-(2,4,6-trimethylanilino)pyridine-2-carboxamide (PubChem CID 109198757) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(2,4,6-trimethylanilino)pyridine-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(2,4,6-trimethylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109198757 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(2,4,6-trimethylanilino)pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c(Nc2ccc(C(=O)Nc3ccc4c(c3)OCO4)nc2)c(C)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-13-8-14(2)21(15(3)9-13)24-17-4-6-18(23-11-17)22(26)25-16-5-7-19-20(10-16)28-12-27-19/h4-11,24H,12H2,1-3H3,(H,25,26) |
| InChIKey | ZRPQEKGAGFLIMZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |