C20H16FN3O2 — CID 109198907
N-(4-acetylphenyl)-5-(2-fluoroanilino)pyridine-2-carboxamide (PubChem CID 109198907) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-(2-fluoroanilino)pyridine-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-5-(2-fluoroanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109198907 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(4-acetylphenyl)-5-(2-fluoroanilino)pyridine-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(Nc3ccccc3F)cn2)cc1 |
| InChI | InChI=1S/C20H16FN3O2/c1-13(25)14-6-8-15(9-7-14)24-20(26)19-11-10-16(12-22-19)23-18-5-3-2-4-17(18)21/h2-12,23H,1H3,(H,24,26) |
| InChIKey | AEBFAABWTHYTFH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |