C21H21N3O4 — CID 109199779
5-(2,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-2-carboxamide (PubChem CID 109199779) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 5-(2,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 5-(2,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109199779 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-(2,4-dimethoxyanilino)-N-(3-methoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc(Nc3ccc(OC)cc3OC)cn2)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-26-16-6-4-5-14(11-16)24-21(25)19-9-7-15(13-22-19)23-18-10-8-17(27-2)12-20(18)28-3/h4-13,23H,1-3H3,(H,24,25) |
| InChIKey | QYTGXULCYVVXIY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |