C21H14F2N4O — CID 109200781
N-(2,6-difluorophenyl)-5-(quinolin-8-ylamino)pyridine-2-carboxamide (PubChem CID 109200781) has the molecular formula C21H14F2N4O and a molecular weight of 376.37 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-(quinolin-8-ylamino)pyridine-2-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-5-(quinolin-8-ylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109200781 |
| Molecular Formula | C21H14F2N4O |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-(quinolin-8-ylamino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1ccc(Nc2cccc3cccnc23)cn1 |
| InChI | InChI=1S/C21H14F2N4O/c22-15-6-2-7-16(23)20(15)27-21(28)18-10-9-14(12-25-18)26-17-8-1-4-13-5-3-11-24-19(13)17/h1-12,26H,(H,27,28) |
| InChIKey | LCWZJKIAFZSQRO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |