C18H19N3O — CID 109202250
4-(2-methyl-2,3-dihydroindol-1-yl)-N-prop-2-enylpyridine-2-carboxamide (PubChem CID 109202250) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(2-methyl-2,3-dihydroindol-1-yl)-N-prop-2-enylpyridine-2-carboxamide.
| Compound Name | 4-(2-methyl-2,3-dihydroindol-1-yl)-N-prop-2-enylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109202250 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-(2-methyl-2,3-dihydroindol-1-yl)-N-prop-2-enylpyridine-2-carboxamide |
| SMILES | C=CCNC(=O)c1cc(N2c3ccccc3CC2C)ccn1 |
| InChI | InChI=1S/C18H19N3O/c1-3-9-20-18(22)16-12-15(8-10-19-16)21-13(2)11-14-6-4-5-7-17(14)21/h3-8,10,12-13H,1,9,11H2,2H3,(H,20,22) |
| InChIKey | VZFCKFVEFJURKK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|