C20H25N3O — CID 109204088
N-cyclopentyl-4-(2,4,6-trimethylanilino)pyridine-2-carboxamide (PubChem CID 109204088) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,4,6-trimethylanilino)pyridine-2-carboxamide.
| Compound Name | N-cyclopentyl-4-(2,4,6-trimethylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109204088 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-cyclopentyl-4-(2,4,6-trimethylanilino)pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c(Nc2ccnc(C(=O)NC3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C20H25N3O/c1-13-10-14(2)19(15(3)11-13)22-17-8-9-21-18(12-17)20(24)23-16-6-4-5-7-16/h8-12,16H,4-7H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | URLHGGUBZMZSOG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |