(2-amino-2-oxoethyl)azanium chloride

C2H7ClN2O — CID 10920470

IUPAC(2-amino-2-oxoethyl)azanium chloride
SMILESNC(=O)C[NH3+].[Cl-]
InChIInChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H
InChIKeyWKNMKGVLOWGGOU-UHFFFAOYSA-N
MW110.54 g/mol
LogP-5.28
Rot. Bonds1

About (2-amino-2-oxoethyl)azanium chloride

(2-amino-2-oxoethyl)azanium chloride (PubChem CID 10920470) has the molecular formula C2H7ClN2O and a molecular weight of 110.54 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)azanium chloride.

Molecular Properties

Compound Name(2-amino-2-oxoethyl)azanium chloride
PubChem CID10920470
Molecular FormulaC2H7ClN2O
Molecular Weight110.54 g/mol
Exact Mass110.02
IUPAC Name(2-amino-2-oxoethyl)azanium chloride
SMILESNC(=O)C[NH3+].[Cl-]
InChIInChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H
InChIKeyWKNMKGVLOWGGOU-UHFFFAOYSA-N
XLogP-5.28
TPSA70.73 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500110.54
LogP ≤ 5-5.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze (2-amino-2-oxoethyl)azanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-amino-2-oxoethyl)azanium chloride?
The IUPAC name of (2-amino-2-oxoethyl)azanium chloride (CID 10920470) is (2-amino-2-oxoethyl)azanium chloride.
What is the SMILES notation for (2-amino-2-oxoethyl)azanium chloride?
The canonical SMILES for (2-amino-2-oxoethyl)azanium chloride is NC(=O)C[NH3+].[Cl-].
What is the InChIKey of (2-amino-2-oxoethyl)azanium chloride?
The InChIKey is WKNMKGVLOWGGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H.
What are the key properties of (2-amino-2-oxoethyl)azanium chloride?
(2-amino-2-oxoethyl)azanium chloride has a molecular weight of 110.54 g/mol, XLogP of -5.28, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl)azanium chloride is sourced from PubChem (CID 10920470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).