About (8aS)-8,8a-dihydro-3H-indolizin-5-one
(8aS)-8,8a-dihydro-3H-indolizin-5-one (PubChem CID 10920559) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is (8aS)-8,8a-dihydro-3H-indolizin-5-one.
Molecular Properties
| Compound Name | (8aS)-8,8a-dihydro-3H-indolizin-5-one |
| PubChem CID | 10920559 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (8aS)-8,8a-dihydro-3H-indolizin-5-one |
| SMILES | O=C1C=CC[C@H]2C=CCN12 |
| InChI | InChI=1S/C8H9NO/c10-8-5-1-3-7-4-2-6-9(7)8/h1-2,4-5,7H,3,6H2/t7-/m0/s1 |
| InChIKey | ZQMVMMOCVVDNOC-ZETCQYMHSA-N |
| XLogP | 0.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (8aS)-8,8a-dihydro-3H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aS)-8,8a-dihydro-3H-indolizin-5-one?
The IUPAC name of (8aS)-8,8a-dihydro-3H-indolizin-5-one (CID 10920559) is (8aS)-8,8a-dihydro-3H-indolizin-5-one.
What is the SMILES notation for (8aS)-8,8a-dihydro-3H-indolizin-5-one?
The canonical SMILES for (8aS)-8,8a-dihydro-3H-indolizin-5-one is O=C1C=CC[C@H]2C=CCN12.
What is the InChIKey of (8aS)-8,8a-dihydro-3H-indolizin-5-one?
The InChIKey is ZQMVMMOCVVDNOC-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H9NO/c10-8-5-1-3-7-4-2-6-9(7)8/h1-2,4-5,7H,3,6H2/t7-/m0/s1.
What are the key properties of (8aS)-8,8a-dihydro-3H-indolizin-5-one?
(8aS)-8,8a-dihydro-3H-indolizin-5-one has a molecular weight of 135.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8aS)-8,8a-dihydro-3H-indolizin-5-one is sourced from PubChem (CID 10920559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).