C17H19Cl2N3O2 — CID 109205915
N-[2-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)pyridine-2-carboxamide (PubChem CID 109205915) has the molecular formula C17H19Cl2N3O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109205915 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-(2-methoxyethylamino)pyridine-2-carboxamide |
| SMILES | COCCNc1ccnc(C(=O)NCCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N3O2/c1-24-9-8-20-14-5-7-21-16(11-14)17(23)22-6-4-12-2-3-13(18)10-15(12)19/h2-3,5,7,10-11H,4,6,8-9H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | RUYTVDXGBHRLOO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|