C15H19N3O3 — CID 109206035
4-(furan-2-ylmethylamino)-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 109206035) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 4-(furan-2-ylmethylamino)-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 4-(furan-2-ylmethylamino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109206035 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-(furan-2-ylmethylamino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc(NCc2ccco2)ccn1 |
| InChI | InChI=1S/C15H19N3O3/c1-20-8-3-6-17-15(19)14-10-12(5-7-16-14)18-11-13-4-2-9-21-13/h2,4-5,7,9-10H,3,6,8,11H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | MXGQMQPKTNIDDF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|