About 1-azido-3-ethenylbenzene
1-azido-3-ethenylbenzene (PubChem CID 10920640) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 1-azido-3-ethenylbenzene.
Molecular Properties
| Compound Name | 1-azido-3-ethenylbenzene |
| PubChem CID | 10920640 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 1-azido-3-ethenylbenzene |
| SMILES | C=Cc1cccc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C8H7N3/c1-2-7-4-3-5-8(6-7)10-11-9/h2-6H,1H2 |
| InChIKey | DBHYHAZBHLULCT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-3-ethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-3-ethenylbenzene?
The IUPAC name of 1-azido-3-ethenylbenzene (CID 10920640) is 1-azido-3-ethenylbenzene.
What is the SMILES notation for 1-azido-3-ethenylbenzene?
The canonical SMILES for 1-azido-3-ethenylbenzene is C=Cc1cccc(N=[N+]=[N-])c1.
What is the InChIKey of 1-azido-3-ethenylbenzene?
The InChIKey is DBHYHAZBHLULCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c1-2-7-4-3-5-8(6-7)10-11-9/h2-6H,1H2.
What are the key properties of 1-azido-3-ethenylbenzene?
1-azido-3-ethenylbenzene has a molecular weight of 145.16 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-3-ethenylbenzene is sourced from PubChem (CID 10920640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).