C10H13N — CID 10920660
6-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 10920660) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 6-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 10920660 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C10H13N/c1-8-2-3-10-7-11-5-4-9(10)6-8/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | JQOUGGPGOWRLPX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |