C22H29N5O — CID 109208189
(4-methylpiperazin-1-yl)-[4-(4-piperidin-1-ylanilino)-2-pyridinyl]methanone (PubChem CID 109208189) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[4-(4-piperidin-1-ylanilino)-2-pyridinyl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[4-(4-piperidin-1-ylanilino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 109208189 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[4-(4-piperidin-1-ylanilino)-2-pyridinyl]methanone |
| SMILES | CN1CCN(C(=O)c2cc(Nc3ccc(N4CCCCC4)cc3)ccn2)CC1 |
| InChI | InChI=1S/C22H29N5O/c1-25-13-15-27(16-14-25)22(28)21-17-19(9-10-23-21)24-18-5-7-20(8-6-18)26-11-3-2-4-12-26/h5-10,17H,2-4,11-16H2,1H3,(H,23,24) |
| InChIKey | QWYPBFZPIJUHOT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|