About 3-hydroxy-2,4,6-trimethylbenzonitrile
3-hydroxy-2,4,6-trimethylbenzonitrile (PubChem CID 10920827) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-hydroxy-2,4,6-trimethylbenzonitrile.
Molecular Properties
| Compound Name | 3-hydroxy-2,4,6-trimethylbenzonitrile |
| PubChem CID | 10920827 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-hydroxy-2,4,6-trimethylbenzonitrile |
| SMILES | Cc1cc(C)c(C#N)c(C)c1O |
| InChI | InChI=1S/C10H11NO/c1-6-4-7(2)10(12)8(3)9(6)5-11/h4,12H,1-3H3 |
| InChIKey | CHUDLOFNRNLTSH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-2,4,6-trimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,4,6-trimethylbenzonitrile?
The IUPAC name of 3-hydroxy-2,4,6-trimethylbenzonitrile (CID 10920827) is 3-hydroxy-2,4,6-trimethylbenzonitrile.
What is the SMILES notation for 3-hydroxy-2,4,6-trimethylbenzonitrile?
The canonical SMILES for 3-hydroxy-2,4,6-trimethylbenzonitrile is Cc1cc(C)c(C#N)c(C)c1O.
What is the InChIKey of 3-hydroxy-2,4,6-trimethylbenzonitrile?
The InChIKey is CHUDLOFNRNLTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-6-4-7(2)10(12)8(3)9(6)5-11/h4,12H,1-3H3.
What are the key properties of 3-hydroxy-2,4,6-trimethylbenzonitrile?
3-hydroxy-2,4,6-trimethylbenzonitrile has a molecular weight of 161.20 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,4,6-trimethylbenzonitrile is sourced from PubChem (CID 10920827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).