C10H13NO — CID 10920847
(NE)-N-[(1S,2R,6S,7R)-3-tricyclo[5.2.1.02,6]dec-8-enylidene]hydroxylamine (PubChem CID 10920847) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (NE)-N-[(1S,2R,6S,7R)-3-tricyclo[5.2.1.02,6]dec-8-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,2R,6S,7R)-3-tricyclo[5.2.1.02,6]dec-8-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 10920847 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (NE)-N-[(1S,2R,6S,7R)-3-tricyclo[5.2.1.02,6]dec-8-enylidene]hydroxylamine |
| SMILES | O/N=C1\CC[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H13NO/c12-11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-2,6-8,10,12H,3-5H2/b11-9+/t6-,7+,8-,10+/m0/s1 |
| InChIKey | JESXZAXCMKXGHT-GMEJJSGTSA-N |
| XLogP | 2.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|