About 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine
1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine (PubChem CID 10920886) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine.
Molecular Properties
| Compound Name | 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine |
| PubChem CID | 10920886 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine |
| SMILES | C=C=C(C)CN(N)CCCC=C |
| InChI | InChI=1S/C10H18N2/c1-4-6-7-8-12(11)9-10(3)5-2/h4H,1-2,6-9,11H2,3H3 |
| InChIKey | SIERVKPTXFROJB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine?
The IUPAC name of 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine (CID 10920886) is 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine.
What is the SMILES notation for 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine?
The canonical SMILES for 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine is C=C=C(C)CN(N)CCCC=C.
What is the InChIKey of 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine?
The InChIKey is SIERVKPTXFROJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-6-7-8-12(11)9-10(3)5-2/h4H,1-2,6-9,11H2,3H3.
What are the key properties of 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine?
1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine has a molecular weight of 166.27 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbuta-2,3-dienyl)-1-pent-4-enylhydrazine is sourced from PubChem (CID 10920886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).