About (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol
(E)-2,5-dimethyl-5-nitrohex-3-en-2-ol (PubChem CID 10920988) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol |
| PubChem CID | 10920988 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol |
| SMILES | CC(C)(O)/C=C/C(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO3/c1-7(2,9(11)12)5-6-8(3,4)10/h5-6,10H,1-4H3/b6-5+ |
| InChIKey | DYPJEGZUFBGTPC-AATRIKPKSA-N |
| XLogP | 1.37 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol?
The IUPAC name of (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol (CID 10920988) is (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol.
What is the SMILES notation for (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol?
The canonical SMILES for (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol is CC(C)(O)/C=C/C(C)(C)[N+](=O)[O-].
What is the InChIKey of (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol?
The InChIKey is DYPJEGZUFBGTPC-AATRIKPKSA-N. The full InChI is InChI=1S/C8H15NO3/c1-7(2,9(11)12)5-6-8(3,4)10/h5-6,10H,1-4H3/b6-5+.
What are the key properties of (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol?
(E)-2,5-dimethyl-5-nitrohex-3-en-2-ol has a molecular weight of 173.21 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-dimethyl-5-nitrohex-3-en-2-ol is sourced from PubChem (CID 10920988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).