About magnesium;(2S)-2-methanidylbutane;bromide
magnesium;(2S)-2-methanidylbutane;bromide (PubChem CID 10921031) has the molecular formula C5H11BrMg
and a molecular weight of 175.35 g/mol. Its IUPAC name is magnesium;(2S)-2-methanidylbutane;bromide.
Molecular Properties
| Compound Name | magnesium;(2S)-2-methanidylbutane;bromide |
| PubChem CID | 10921031 |
| Molecular Formula | C5H11BrMg |
| Molecular Weight | 175.35 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | magnesium;(2S)-2-methanidylbutane;bromide |
| SMILES | [Br-].[CH2-][C@@H](C)CC.[Mg+2] |
| InChI | InChI=1S/C5H11.BrH.Mg/c1-4-5(2)3;;/h5H,2,4H2,1,3H3;1H;/q-1;;+2/p-1/t5-;;/m0../s1 |
| InChIKey | BWXRAPAVYLNVEV-XRIGFGBMSA-M |
| XLogP | -1.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.35 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;(2S)-2-methanidylbutane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(2S)-2-methanidylbutane;bromide?
The IUPAC name of magnesium;(2S)-2-methanidylbutane;bromide (CID 10921031) is magnesium;(2S)-2-methanidylbutane;bromide.
What is the SMILES notation for magnesium;(2S)-2-methanidylbutane;bromide?
The canonical SMILES for magnesium;(2S)-2-methanidylbutane;bromide is [Br-].[CH2-][C@@H](C)CC.[Mg+2].
What is the InChIKey of magnesium;(2S)-2-methanidylbutane;bromide?
The InChIKey is BWXRAPAVYLNVEV-XRIGFGBMSA-M. The full InChI is InChI=1S/C5H11.BrH.Mg/c1-4-5(2)3;;/h5H,2,4H2,1,3H3;1H;/q-1;;+2/p-1/t5-;;/m0../s1.
What are the key properties of magnesium;(2S)-2-methanidylbutane;bromide?
magnesium;(2S)-2-methanidylbutane;bromide has a molecular weight of 175.35 g/mol, XLogP of -1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(2S)-2-methanidylbutane;bromide is sourced from PubChem (CID 10921031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).