C20H17Cl2N3O — CID 109211114
4-[benzyl(methyl)amino]-N-(2,4-dichlorophenyl)pyridine-2-carboxamide (PubChem CID 109211114) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is 4-[benzyl(methyl)amino]-N-(2,4-dichlorophenyl)pyridine-2-carboxamide.
| Compound Name | 4-[benzyl(methyl)amino]-N-(2,4-dichlorophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109211114 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-[benzyl(methyl)amino]-N-(2,4-dichlorophenyl)pyridine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)c1ccnc(C(=O)Nc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H17Cl2N3O/c1-25(13-14-5-3-2-4-6-14)16-9-10-23-19(12-16)20(26)24-18-8-7-15(21)11-17(18)22/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | AMBIXRXZPBYPBA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |