C10H16O3 — CID 10921190
(3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one (PubChem CID 10921190) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is (3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one.
| Compound Name | (3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one |
|---|---|
| PubChem CID | 10921190 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3S,6E,8E)-1,3-dihydroxydeca-6,8-dien-5-one |
| SMILES | C/C=C/C=C/C(=O)C[C@@H](O)CCO |
| InChI | InChI=1S/C10H16O3/c1-2-3-4-5-9(12)8-10(13)6-7-11/h2-5,10-11,13H,6-8H2,1H3/b3-2+,5-4+/t10-/m0/s1 |
| InChIKey | HEBWYFWQEUKRPQ-PQSAUHCHSA-N |
| XLogP | 0.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|