C22H21N3O3 — CID 109212418
4-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenylethyl)pyridine-2-carboxamide (PubChem CID 109212418) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenylethyl)pyridine-2-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109212418 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenylethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(NCc2ccc3c(c2)OCO3)ccn1 |
| InChI | InChI=1S/C22H21N3O3/c26-22(24-10-8-16-4-2-1-3-5-16)19-13-18(9-11-23-19)25-14-17-6-7-20-21(12-17)28-15-27-20/h1-7,9,11-13H,8,10,14-15H2,(H,23,25)(H,24,26) |
| InChIKey | DJRLEVYVFXXCCU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |