C18H15ClN4O — CID 109212879
N-(2-chlorophenyl)-4-(pyridin-2-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109212879) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(pyridin-2-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-(pyridin-2-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109212879 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-(2-chlorophenyl)-4-(pyridin-2-ylmethylamino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc(NCc2ccccn2)ccn1 |
| InChI | InChI=1S/C18H15ClN4O/c19-15-6-1-2-7-16(15)23-18(24)17-11-13(8-10-21-17)22-12-14-5-3-4-9-20-14/h1-11H,12H2,(H,21,22)(H,23,24) |
| InChIKey | IXNWHIOLXZDQDM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |