About 2-(1-phenylethenyl)oxane
2-(1-phenylethenyl)oxane (PubChem CID 10921290) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(1-phenylethenyl)oxane.
Molecular Properties
| Compound Name | 2-(1-phenylethenyl)oxane |
| PubChem CID | 10921290 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(1-phenylethenyl)oxane |
| SMILES | C=C(c1ccccc1)C1CCCCO1 |
| InChI | InChI=1S/C13H16O/c1-11(12-7-3-2-4-8-12)13-9-5-6-10-14-13/h2-4,7-8,13H,1,5-6,9-10H2 |
| InChIKey | HUEOSFJLBXLUGS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-phenylethenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-phenylethenyl)oxane?
The IUPAC name of 2-(1-phenylethenyl)oxane (CID 10921290) is 2-(1-phenylethenyl)oxane.
What is the SMILES notation for 2-(1-phenylethenyl)oxane?
The canonical SMILES for 2-(1-phenylethenyl)oxane is C=C(c1ccccc1)C1CCCCO1.
What is the InChIKey of 2-(1-phenylethenyl)oxane?
The InChIKey is HUEOSFJLBXLUGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-11(12-7-3-2-4-8-12)13-9-5-6-10-14-13/h2-4,7-8,13H,1,5-6,9-10H2.
What are the key properties of 2-(1-phenylethenyl)oxane?
2-(1-phenylethenyl)oxane has a molecular weight of 188.27 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-phenylethenyl)oxane is sourced from PubChem (CID 10921290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).