C9H16O2S — CID 10921296
(4aS,8aS)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d][1,3]dioxine (PubChem CID 10921296) has the molecular formula C9H16O2S and a molecular weight of 188.29 g/mol. Its IUPAC name is (4aS,8aS)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aS,8aS)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10921296 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (4aS,8aS)-2,2-dimethyl-4,4a,6,7,8,8a-hexahydrothiopyrano[3,2-d][1,3]dioxine |
| SMILES | CC1(C)OC[C@@H]2SCCC[C@@H]2O1 |
| InChI | InChI=1S/C9H16O2S/c1-9(2)10-6-8-7(11-9)4-3-5-12-8/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | JEAXPASZFLHLRX-YUMQZZPRSA-N |
| XLogP | 2.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |