About 4-methyl-1H-quinoline-2,5,8-trione
4-methyl-1H-quinoline-2,5,8-trione (PubChem CID 10921303) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is 4-methyl-1H-quinoline-2,5,8-trione.
Molecular Properties
| Compound Name | 4-methyl-1H-quinoline-2,5,8-trione |
| PubChem CID | 10921303 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 4-methyl-1H-quinoline-2,5,8-trione |
| SMILES | Cc1cc(=O)[nH]c2c1C(=O)C=CC2=O |
| InChI | InChI=1S/C10H7NO3/c1-5-4-8(14)11-10-7(13)3-2-6(12)9(5)10/h2-4H,1H3,(H,11,14) |
| InChIKey | AEXYBXXYRZKXQL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1H-quinoline-2,5,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-quinoline-2,5,8-trione?
The IUPAC name of 4-methyl-1H-quinoline-2,5,8-trione (CID 10921303) is 4-methyl-1H-quinoline-2,5,8-trione.
What is the SMILES notation for 4-methyl-1H-quinoline-2,5,8-trione?
The canonical SMILES for 4-methyl-1H-quinoline-2,5,8-trione is Cc1cc(=O)[nH]c2c1C(=O)C=CC2=O.
What is the InChIKey of 4-methyl-1H-quinoline-2,5,8-trione?
The InChIKey is AEXYBXXYRZKXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c1-5-4-8(14)11-10-7(13)3-2-6(12)9(5)10/h2-4H,1H3,(H,11,14).
What are the key properties of 4-methyl-1H-quinoline-2,5,8-trione?
4-methyl-1H-quinoline-2,5,8-trione has a molecular weight of 189.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-quinoline-2,5,8-trione is sourced from PubChem (CID 10921303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).