C19H17ClN4O — CID 109213171
N-(3-chloro-4-methylphenyl)-4-(pyridin-3-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109213171) has the molecular formula C19H17ClN4O and a molecular weight of 352.83 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-4-(pyridin-3-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-4-(pyridin-3-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109213171 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-4-(pyridin-3-ylmethylamino)pyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(NCc3cccnc3)ccn2)cc1Cl |
| InChI | InChI=1S/C19H17ClN4O/c1-13-4-5-16(9-17(13)20)24-19(25)18-10-15(6-8-22-18)23-12-14-3-2-7-21-11-14/h2-11H,12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HYHHUNNHAJVXEA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |