C13H18O — CID 10921331
4,4,7-trimethyl-3,6,7,8-tetrahydronaphthalen-2-one (PubChem CID 10921331) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 4,4,7-trimethyl-3,6,7,8-tetrahydronaphthalen-2-one.
| Compound Name | 4,4,7-trimethyl-3,6,7,8-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10921331 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 4,4,7-trimethyl-3,6,7,8-tetrahydronaphthalen-2-one |
| SMILES | CC1CC=C2C(=CC(=O)CC2(C)C)C1 |
| InChI | InChI=1S/C13H18O/c1-9-4-5-12-10(6-9)7-11(14)8-13(12,2)3/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | ZSBCDKWXZDNIJV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |