C12H17NO — CID 10921348
(3S,8aR)-2,3,8a-trimethyl-4,6-dihydro-3H-isoquinolin-1-one (PubChem CID 10921348) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (3S,8aR)-2,3,8a-trimethyl-4,6-dihydro-3H-isoquinolin-1-one.
| Compound Name | (3S,8aR)-2,3,8a-trimethyl-4,6-dihydro-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 10921348 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3S,8aR)-2,3,8a-trimethyl-4,6-dihydro-3H-isoquinolin-1-one |
| SMILES | C[C@H]1CC2=CCC=C[C@@]2(C)C(=O)N1C |
| InChI | InChI=1S/C12H17NO/c1-9-8-10-6-4-5-7-12(10,2)11(14)13(9)3/h5-7,9H,4,8H2,1-3H3/t9-,12+/m0/s1 |
| InChIKey | YQJQGBJZVLSVNS-JOYOIKCWSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|