C19H24FN3O — CID 109213953
N-[2-(2-fluorophenyl)ethyl]-4-(pentylamino)pyridine-2-carboxamide (PubChem CID 109213953) has the molecular formula C19H24FN3O and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-4-(pentylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-4-(pentylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109213953 |
| Molecular Formula | C19H24FN3O |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-4-(pentylamino)pyridine-2-carboxamide |
| SMILES | CCCCCNc1ccnc(C(=O)NCCc2ccccc2F)c1 |
| InChI | InChI=1S/C19H24FN3O/c1-2-3-6-11-21-16-10-13-22-18(14-16)19(24)23-12-9-15-7-4-5-8-17(15)20/h4-5,7-8,10,13-14H,2-3,6,9,11-12H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | JKHXKIRSQFNFTI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|