About 2-phenylsulfanylpentanal
2-phenylsulfanylpentanal (PubChem CID 10921416) has the molecular formula C11H14OS
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-phenylsulfanylpentanal.
Molecular Properties
| Compound Name | 2-phenylsulfanylpentanal |
| PubChem CID | 10921416 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-phenylsulfanylpentanal |
| SMILES | CCCC(C=O)Sc1ccccc1 |
| InChI | InChI=1S/C11H14OS/c1-2-6-11(9-12)13-10-7-4-3-5-8-10/h3-5,7-9,11H,2,6H2,1H3 |
| InChIKey | FMMYXZLBUJXWKX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylsulfanylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylpentanal?
The IUPAC name of 2-phenylsulfanylpentanal (CID 10921416) is 2-phenylsulfanylpentanal.
What is the SMILES notation for 2-phenylsulfanylpentanal?
The canonical SMILES for 2-phenylsulfanylpentanal is CCCC(C=O)Sc1ccccc1.
What is the InChIKey of 2-phenylsulfanylpentanal?
The InChIKey is FMMYXZLBUJXWKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14OS/c1-2-6-11(9-12)13-10-7-4-3-5-8-10/h3-5,7-9,11H,2,6H2,1H3.
What are the key properties of 2-phenylsulfanylpentanal?
2-phenylsulfanylpentanal has a molecular weight of 194.30 g/mol, XLogP of 3.15, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylpentanal is sourced from PubChem (CID 10921416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).