C22H20FN3O3 — CID 109214162
methyl 4-[[2-[2-(4-fluorophenyl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate (PubChem CID 109214162) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is methyl 4-[[2-[2-(4-fluorophenyl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(4-fluorophenyl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109214162 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | methyl 4-[[2-[2-(4-fluorophenyl)ethylcarbamoyl]-4-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccnc(C(=O)NCCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C22H20FN3O3/c1-29-22(28)16-4-8-18(9-5-16)26-19-11-13-24-20(14-19)21(27)25-12-10-15-2-6-17(23)7-3-15/h2-9,11,13-14H,10,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | MXFAMGBACFENMV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |