6-phosphonohexanoic acid

C6H13O5P — CID 10921447

IUPAC6-phosphonohexanoic acid
SMILESO=C(O)CCCCCP(=O)(O)O
InChIInChI=1S/C6H13O5P/c7-6(8)4-2-1-3-5-12(9,10)11/h1-5H2,(H,7,8)(H2,9,10,11)
InChIKeySYFTUNQVCGSBOV-UHFFFAOYSA-N
MW196.14 g/mol
LogP0.81
Rot. Bonds6

About 6-phosphonohexanoic acid

6-phosphonohexanoic acid (PubChem CID 10921447) has the molecular formula C6H13O5P and a molecular weight of 196.14 g/mol. Its IUPAC name is 6-phosphonohexanoic acid.

Molecular Properties

Compound Name6-phosphonohexanoic acid
PubChem CID10921447
Molecular FormulaC6H13O5P
Molecular Weight196.14 g/mol
Exact Mass196.05
IUPAC Name6-phosphonohexanoic acid
SMILESO=C(O)CCCCCP(=O)(O)O
InChIInChI=1S/C6H13O5P/c7-6(8)4-2-1-3-5-12(9,10)11/h1-5H2,(H,7,8)(H2,9,10,11)
InChIKeySYFTUNQVCGSBOV-UHFFFAOYSA-N
XLogP0.81
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.14
LogP ≤ 50.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 6-phosphonohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-phosphonohexanoic acid?
The IUPAC name of 6-phosphonohexanoic acid (CID 10921447) is 6-phosphonohexanoic acid.
What is the SMILES notation for 6-phosphonohexanoic acid?
The canonical SMILES for 6-phosphonohexanoic acid is O=C(O)CCCCCP(=O)(O)O.
What is the InChIKey of 6-phosphonohexanoic acid?
The InChIKey is SYFTUNQVCGSBOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13O5P/c7-6(8)4-2-1-3-5-12(9,10)11/h1-5H2,(H,7,8)(H2,9,10,11).
What are the key properties of 6-phosphonohexanoic acid?
6-phosphonohexanoic acid has a molecular weight of 196.14 g/mol, XLogP of 0.81, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phosphonohexanoic acid is sourced from PubChem (CID 10921447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).