C20H24N4O3 — CID 109215913
ethyl 4-[4-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 109215913) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl 4-[4-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109215913 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl 4-[4-(3-methylanilino)pyridine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(Nc3cccc(C)c3)ccn2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c1-3-27-20(26)24-11-9-23(10-12-24)19(25)18-14-17(7-8-21-18)22-16-6-4-5-15(2)13-16/h4-8,13-14H,3,9-12H2,1-2H3,(H,21,22) |
| InChIKey | GJXLFAUXHDITHT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |