C22H29N3O — CID 109216380
4-(4-benzylpiperidin-1-yl)-N,N-diethylpyridine-2-carboxamide (PubChem CID 109216380) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-N,N-diethylpyridine-2-carboxamide.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-N,N-diethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109216380 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-N,N-diethylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(N2CCC(Cc3ccccc3)CC2)ccn1 |
| InChI | InChI=1S/C22H29N3O/c1-3-24(4-2)22(26)21-17-20(10-13-23-21)25-14-11-19(12-15-25)16-18-8-6-5-7-9-18/h5-10,13,17,19H,3-4,11-12,14-16H2,1-2H3 |
| InChIKey | GVVMEFKHUMORPJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |