C23H25N3O — CID 109216457
4-(N-benzylanilino)-N,N-diethylpyridine-2-carboxamide (PubChem CID 109216457) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-(N-benzylanilino)-N,N-diethylpyridine-2-carboxamide.
| Compound Name | 4-(N-benzylanilino)-N,N-diethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109216457 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-(N-benzylanilino)-N,N-diethylpyridine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(N(Cc2ccccc2)c2ccccc2)ccn1 |
| InChI | InChI=1S/C23H25N3O/c1-3-25(4-2)23(27)22-17-21(15-16-24-22)26(20-13-9-6-10-14-20)18-19-11-7-5-8-12-19/h5-17H,3-4,18H2,1-2H3 |
| InChIKey | XZIOFLYPSUSISA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |