C22H29N3O2 — CID 109217095
N-cycloheptyl-4-(4-propan-2-yloxyanilino)pyridine-2-carboxamide (PubChem CID 109217095) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-cycloheptyl-4-(4-propan-2-yloxyanilino)pyridine-2-carboxamide.
| Compound Name | N-cycloheptyl-4-(4-propan-2-yloxyanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109217095 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-cycloheptyl-4-(4-propan-2-yloxyanilino)pyridine-2-carboxamide |
| SMILES | CC(C)Oc1ccc(Nc2ccnc(C(=O)NC3CCCCCC3)c2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-16(2)27-20-11-9-18(10-12-20)24-19-13-14-23-21(15-19)22(26)25-17-7-5-3-4-6-8-17/h9-17H,3-8H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | GHGVUBJGRQEKSF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |