About [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate
[(2R)-but-3-en-2-yl] 3-oxooct-7-enoate (PubChem CID 10921757) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate.
Molecular Properties
| Compound Name | [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate |
| PubChem CID | 10921757 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate |
| SMILES | C=CCCCC(=O)CC(=O)O[C@H](C)C=C |
| InChI | InChI=1S/C12H18O3/c1-4-6-7-8-11(13)9-12(14)15-10(3)5-2/h4-5,10H,1-2,6-9H2,3H3/t10-/m1/s1 |
| InChIKey | HLTWPTWRQJHTSK-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate?
The IUPAC name of [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate (CID 10921757) is [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate.
What is the SMILES notation for [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate?
The canonical SMILES for [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate is C=CCCCC(=O)CC(=O)O[C@H](C)C=C.
What is the InChIKey of [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate?
The InChIKey is HLTWPTWRQJHTSK-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H18O3/c1-4-6-7-8-11(13)9-12(14)15-10(3)5-2/h4-5,10H,1-2,6-9H2,3H3/t10-/m1/s1.
What are the key properties of [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate?
[(2R)-but-3-en-2-yl] 3-oxooct-7-enoate has a molecular weight of 210.27 g/mol, XLogP of 2.42, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-but-3-en-2-yl] 3-oxooct-7-enoate is sourced from PubChem (CID 10921757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).