C12H25BO2 — CID 10921795
2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 10921795) has the molecular formula C12H25BO2 and a molecular weight of 212.14 g/mol. Its IUPAC name is 2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10921795 |
| Molecular Formula | C12H25BO2 |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-hexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H25BO2/c1-6-7-8-9-10-13-14-11(2,3)12(4,5)15-13/h6-10H2,1-5H3 |
| InChIKey | LDPMCSWZEGKWLC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|