C21H21N3O — CID 109219004
N-(3,4-dimethylphenyl)-4-(2-methylanilino)pyridine-2-carboxamide (PubChem CID 109219004) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-(2-methylanilino)pyridine-2-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-(2-methylanilino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109219004 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-(2-methylanilino)pyridine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Nc3ccccc3C)ccn2)cc1C |
| InChI | InChI=1S/C21H21N3O/c1-14-8-9-17(12-16(14)3)24-21(25)20-13-18(10-11-22-20)23-19-7-5-4-6-15(19)2/h4-13H,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | NBLKKFARJDXOQX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |