About dipropan-2-yl (2R)-2-hydroxybutanedioate
dipropan-2-yl (2R)-2-hydroxybutanedioate (PubChem CID 10921962) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is dipropan-2-yl (2R)-2-hydroxybutanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl (2R)-2-hydroxybutanedioate |
| PubChem CID | 10921962 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | dipropan-2-yl (2R)-2-hydroxybutanedioate |
| SMILES | CC(C)OC(=O)C[C@@H](O)C(=O)OC(C)C |
| InChI | InChI=1S/C10H18O5/c1-6(2)14-9(12)5-8(11)10(13)15-7(3)4/h6-8,11H,5H2,1-4H3/t8-/m1/s1 |
| InChIKey | XYVHRFVONMVDGK-MRVPVSSYSA-N |
| XLogP | 0.64 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipropan-2-yl (2R)-2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl (2R)-2-hydroxybutanedioate?
The IUPAC name of dipropan-2-yl (2R)-2-hydroxybutanedioate (CID 10921962) is dipropan-2-yl (2R)-2-hydroxybutanedioate.
What is the SMILES notation for dipropan-2-yl (2R)-2-hydroxybutanedioate?
The canonical SMILES for dipropan-2-yl (2R)-2-hydroxybutanedioate is CC(C)OC(=O)C[C@@H](O)C(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl (2R)-2-hydroxybutanedioate?
The InChIKey is XYVHRFVONMVDGK-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H18O5/c1-6(2)14-9(12)5-8(11)10(13)15-7(3)4/h6-8,11H,5H2,1-4H3/t8-/m1/s1.
What are the key properties of dipropan-2-yl (2R)-2-hydroxybutanedioate?
dipropan-2-yl (2R)-2-hydroxybutanedioate has a molecular weight of 218.25 g/mol, XLogP of 0.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl (2R)-2-hydroxybutanedioate is sourced from PubChem (CID 10921962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).